C10H13NO4S — CID 99976891
N-[(3S)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)formamide (PubChem CID 99976891) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)formamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)formamide |
|---|---|
| PubChem CID | 99976891 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)formamide |
| SMILES | O=CN(Cc1ccco1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H13NO4S/c12-8-11(6-10-2-1-4-15-10)9-3-5-16(13,14)7-9/h1-2,4,8-9H,3,5-7H2/t9-/m0/s1 |
| InChIKey | KCZMWPSOGCDCBT-VIFPVBQESA-N |
| XLogP | 0.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|