About 3-cyclohexyloxythiolane 1,1-dioxide
3-cyclohexyloxythiolane 1,1-dioxide (PubChem CID 4585423) has the molecular formula C10H18O3S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 3-cyclohexyloxythiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-cyclohexyloxythiolane 1,1-dioxide |
| PubChem CID | 4585423 |
| Molecular Formula | C10H18O3S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 3-cyclohexyloxythiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(OC2CCCCC2)C1 |
| InChI | InChI=1S/C10H18O3S/c11-14(12)7-6-10(8-14)13-9-4-2-1-3-5-9/h9-10H,1-8H2 |
| InChIKey | MDUJHYSQQKZZLX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexyloxythiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyloxythiolane 1,1-dioxide?
The IUPAC name of 3-cyclohexyloxythiolane 1,1-dioxide (CID 4585423) is 3-cyclohexyloxythiolane 1,1-dioxide.
What is the SMILES notation for 3-cyclohexyloxythiolane 1,1-dioxide?
The canonical SMILES for 3-cyclohexyloxythiolane 1,1-dioxide is O=S1(=O)CCC(OC2CCCCC2)C1.
What is the InChIKey of 3-cyclohexyloxythiolane 1,1-dioxide?
The InChIKey is MDUJHYSQQKZZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3S/c11-14(12)7-6-10(8-14)13-9-4-2-1-3-5-9/h9-10H,1-8H2.
What are the key properties of 3-cyclohexyloxythiolane 1,1-dioxide?
3-cyclohexyloxythiolane 1,1-dioxide has a molecular weight of 218.32 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyloxythiolane 1,1-dioxide is sourced from PubChem (CID 4585423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).