C6H10O5S2 — CID 155217659
(1,1-dioxothiolan-3-yl) ethenesulfonate (PubChem CID 155217659) has the molecular formula C6H10O5S2 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) ethenesulfonate.
| Compound Name | (1,1-dioxothiolan-3-yl) ethenesulfonate |
|---|---|
| PubChem CID | 155217659 |
| Molecular Formula | C6H10O5S2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) ethenesulfonate |
| SMILES | C=CS(=O)(=O)OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H10O5S2/c1-2-13(9,10)11-6-3-4-12(7,8)5-6/h2,6H,1,3-5H2 |
| InChIKey | IXSYAOZPJGXHBY-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|