C7H12N2O6S2 — CID 167046399
(1,1-dioxothiolan-3-yl) N-amino-N-ethenylsulfonylcarbamate (PubChem CID 167046399) has the molecular formula C7H12N2O6S2 and a molecular weight of 284.31 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) N-amino-N-ethenylsulfonylcarbamate.
| Compound Name | (1,1-dioxothiolan-3-yl) N-amino-N-ethenylsulfonylcarbamate |
|---|---|
| PubChem CID | 167046399 |
| Molecular Formula | C7H12N2O6S2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) N-amino-N-ethenylsulfonylcarbamate |
| SMILES | C=CS(=O)(=O)N(N)C(=O)OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12N2O6S2/c1-2-17(13,14)9(8)7(10)15-6-3-4-16(11,12)5-6/h2,6H,1,3-5,8H2 |
| InChIKey | GNZBGDKPNAMUCY-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|