C9H13F6N2O7PS — CID 167046449
(1,1-dioxothiolan-3-yl) N-amino-N-[bis(2,2,2-trifluoroethoxy)phosphoryl]carbamate (PubChem CID 167046449) has the molecular formula C9H13F6N2O7PS and a molecular weight of 438.24 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) N-amino-N-[bis(2,2,2-trifluoroethoxy)phosphoryl]carbamate.
| Compound Name | (1,1-dioxothiolan-3-yl) N-amino-N-[bis(2,2,2-trifluoroethoxy)phosphoryl]carbamate |
|---|---|
| PubChem CID | 167046449 |
| Molecular Formula | C9H13F6N2O7PS |
| Molecular Weight | 438.24 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) N-amino-N-[bis(2,2,2-trifluoroethoxy)phosphoryl]carbamate |
| SMILES | NN(C(=O)OC1CCS(=O)(=O)C1)P(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C9H13F6N2O7PS/c10-8(11,12)4-22-25(19,23-5-9(13,14)15)17(16)7(18)24-6-1-2-26(20,21)3-6/h6H,1-5,16H2 |
| InChIKey | SGNBJDYCASBVTJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|