C5H8N2O7S2 — CID 167046536
(2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate (PubChem CID 167046536) has the molecular formula C5H8N2O7S2 and a molecular weight of 272.26 g/mol. Its IUPAC name is (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate.
| Compound Name | (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate |
|---|---|
| PubChem CID | 167046536 |
| Molecular Formula | C5H8N2O7S2 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate |
| SMILES | C=CS(=O)(=O)N(N)C(=O)OC1COS(=O)O1 |
| InChI | InChI=1S/C5H8N2O7S2/c1-2-16(10,11)7(6)5(8)13-4-3-12-15(9)14-4/h2,4H,1,3,6H2 |
| InChIKey | GHCJYFMMAJQOTR-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|