About (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate
(2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate (PubChem CID 167046536) has the molecular formula C5H8N2O7S2
and a molecular weight of 272.26 g/mol. Its IUPAC name is (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate.
Molecular Properties
| Compound Name | (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate |
| PubChem CID | 167046536 |
| Molecular Formula | C5H8N2O7S2 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate |
| SMILES | C=CS(=O)(=O)N(N)C(=O)OC1COS(=O)O1 |
| InChI | InChI=1S/C5H8N2O7S2/c1-2-16(10,11)7(6)5(8)13-4-3-12-15(9)14-4/h2,4H,1,3,6H2 |
| InChIKey | GHCJYFMMAJQOTR-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate?
The IUPAC name of (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate (CID 167046536) is (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate.
What is the SMILES notation for (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate?
The canonical SMILES for (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate is C=CS(=O)(=O)N(N)C(=O)OC1COS(=O)O1.
What is the InChIKey of (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate?
The InChIKey is GHCJYFMMAJQOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O7S2/c1-2-16(10,11)7(6)5(8)13-4-3-12-15(9)14-4/h2,4H,1,3,6H2.
What are the key properties of (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate?
(2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate has a molecular weight of 272.26 g/mol, XLogP of -1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,3,2-dioxathiolan-4-yl) N-amino-N-ethenylsulfonylcarbamate is sourced from PubChem (CID 167046536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).