C10H12N4O10S2 — CID 118491575
(2,5-dioxopyrrolidin-1-yl) N-[aminooxycarbonyl(ethenylsulfonyl)amino]-N-ethenylsulfonylcarbamate (PubChem CID 118491575) has the molecular formula C10H12N4O10S2 and a molecular weight of 412.36 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-[aminooxycarbonyl(ethenylsulfonyl)amino]-N-ethenylsulfonylcarbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-[aminooxycarbonyl(ethenylsulfonyl)amino]-N-ethenylsulfonylcarbamate |
|---|---|
| PubChem CID | 118491575 |
| Molecular Formula | C10H12N4O10S2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-[aminooxycarbonyl(ethenylsulfonyl)amino]-N-ethenylsulfonylcarbamate |
| SMILES | C=CS(=O)(=O)N(C(=O)ON)N(C(=O)ON1C(=O)CCC1=O)S(=O)(=O)C=C |
| InChI | InChI=1S/C10H12N4O10S2/c1-3-25(19,20)13(9(17)23-11)14(26(21,22)4-2)10(18)24-12-7(15)5-6-8(12)16/h3-4H,1-2,5-6,11H2 |
| InChIKey | WYXSIKCSHPZIJR-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 190.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|