C9H12Cl2N2O4 — CID 13111905
(2,5-dioxopyrrolidin-1-yl) N,N-bis(2-chloroethyl)carbamate (PubChem CID 13111905) has the molecular formula C9H12Cl2N2O4 and a molecular weight of 283.11 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N,N-bis(2-chloroethyl)carbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N,N-bis(2-chloroethyl)carbamate |
|---|---|
| PubChem CID | 13111905 |
| Molecular Formula | C9H12Cl2N2O4 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N,N-bis(2-chloroethyl)carbamate |
| SMILES | O=C(ON1C(=O)CCC1=O)N(CCCl)CCCl |
| InChI | InChI=1S/C9H12Cl2N2O4/c10-3-5-12(6-4-11)9(16)17-13-7(14)1-2-8(13)15/h1-6H2 |
| InChIKey | JZVQQKRZNVIBIB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|