C8H9NO7 — CID 175504057
2-O-(2,5-dioxopyrrolidin-1-yl) 1-O-(2-hydroxyethyl) oxalate (PubChem CID 175504057) has the molecular formula C8H9NO7 and a molecular weight of 231.16 g/mol. Its IUPAC name is 2-O-(2,5-dioxopyrrolidin-1-yl) 1-O-(2-hydroxyethyl) oxalate.
| Compound Name | 2-O-(2,5-dioxopyrrolidin-1-yl) 1-O-(2-hydroxyethyl) oxalate |
|---|---|
| PubChem CID | 175504057 |
| Molecular Formula | C8H9NO7 |
| Molecular Weight | 231.16 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-O-(2,5-dioxopyrrolidin-1-yl) 1-O-(2-hydroxyethyl) oxalate |
| SMILES | O=C(OCCO)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C8H9NO7/c10-3-4-15-7(13)8(14)16-9-5(11)1-2-6(9)12/h10H,1-4H2 |
| InChIKey | GSOOLVHIASVEEH-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.16 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|