C8H10N2O5S — CID 88857919
(2,5-dioxopyrrolidin-1-yl) (3R)-3-amino-2-oxo-4-sulfanylbutanoate (PubChem CID 88857919) has the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (3R)-3-amino-2-oxo-4-sulfanylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (3R)-3-amino-2-oxo-4-sulfanylbutanoate |
|---|---|
| PubChem CID | 88857919 |
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (3R)-3-amino-2-oxo-4-sulfanylbutanoate |
| SMILES | N[C@@H](CS)C(=O)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C8H10N2O5S/c9-4(3-16)7(13)8(14)15-10-5(11)1-2-6(10)12/h4,16H,1-3,9H2/t4-/m0/s1 |
| InChIKey | XCPZNZZDKMRXRO-BYPYZUCNSA-N |
| XLogP | -1.58 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|