C12H12N2O6S — CID 130281915
(2,5-dioxopyrrolidin-1-yl) 4-(2,5-dioxopyrrol-1-yl)-2-sulfanylbutanoate (PubChem CID 130281915) has the molecular formula C12H12N2O6S and a molecular weight of 312.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(2,5-dioxopyrrol-1-yl)-2-sulfanylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(2,5-dioxopyrrol-1-yl)-2-sulfanylbutanoate |
|---|---|
| PubChem CID | 130281915 |
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(2,5-dioxopyrrol-1-yl)-2-sulfanylbutanoate |
| SMILES | O=C(ON1C(=O)CCC1=O)C(S)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H12N2O6S/c15-8-1-2-9(16)13(8)6-5-7(21)12(19)20-14-10(17)3-4-11(14)18/h1-2,7,21H,3-6H2 |
| InChIKey | BMCDCKZVEPFCEV-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|