C13H15N2O8P — CID 118342136
[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]phosphinic acid (PubChem CID 118342136) has the molecular formula C13H15N2O8P and a molecular weight of 358.24 g/mol. Its IUPAC name is [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]phosphinic acid.
| Compound Name | [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]phosphinic acid |
|---|---|
| PubChem CID | 118342136 |
| Molecular Formula | C13H15N2O8P |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]phosphinic acid |
| SMILES | O=C(CCP(=O)(O)CCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H15N2O8P/c16-9-1-2-10(17)14(9)6-8-24(21,22)7-5-13(20)23-15-11(18)3-4-12(15)19/h1-2H,3-8H2,(H,21,22) |
| InChIKey | IGFSHISMAJTSLJ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|