C28H30N6O14 — CID 130269332
(2,5-dioxopyrrolidin-1-yl) 3-[[3-(2,5-dioxopyrrolidin-1-yl)peroxypropyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoate (PubChem CID 130269332) has the molecular formula C28H30N6O14 and a molecular weight of 674.58 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[[3-(2,5-dioxopyrrolidin-1-yl)peroxypropyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[[3-(2,5-dioxopyrrolidin-1-yl)peroxypropyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 130269332 |
| Molecular Formula | C28H30N6O14 |
| Molecular Weight | 674.58 g/mol |
| Exact Mass | 674.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[[3-(2,5-dioxopyrrolidin-1-yl)peroxypropyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]propanoate |
| SMILES | O=C(CCN(C(=O)CCN1C(=O)C=CC1=O)N(CCCOON1C(=O)CCC1=O)C(=O)CCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C28H30N6O14/c35-18-2-3-19(36)29(18)14-10-22(39)31(13-1-17-46-48-34-26(43)8-9-27(34)44)32(23(40)11-15-30-20(37)4-5-21(30)38)16-12-28(45)47-33-24(41)6-7-25(33)42/h2-5H,1,6-17H2 |
| InChIKey | JVMVZUOVVLCJHT-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 234.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.58 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|