C18H25N3O10S — CID 170071992
(2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(2-methoxyethoxy)ethylsulfonyl]amino]propanoate (PubChem CID 170071992) has the molecular formula C18H25N3O10S and a molecular weight of 475.48 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(2-methoxyethoxy)ethylsulfonyl]amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(2-methoxyethoxy)ethylsulfonyl]amino]propanoate |
|---|---|
| PubChem CID | 170071992 |
| Molecular Formula | C18H25N3O10S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(2-methoxyethoxy)ethylsulfonyl]amino]propanoate |
| SMILES | COCCOCCS(=O)(=O)N(CCC(=O)ON1C(=O)CCC1=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H25N3O10S/c1-29-10-11-30-12-13-32(27,28)19(8-9-20-14(22)2-3-15(20)23)7-6-18(26)31-21-16(24)4-5-17(21)25/h2-3H,4-13H2,1H3 |
| InChIKey | OSVAOJAXADULBI-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 156.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|