C13H20N2O7S — CID 170071988
3-[2-(2,5-dioxopyrrol-1-yl)ethyl-(2-ethoxyethylsulfonyl)amino]propanoic acid (PubChem CID 170071988) has the molecular formula C13H20N2O7S and a molecular weight of 348.38 g/mol. Its IUPAC name is 3-[2-(2,5-dioxopyrrol-1-yl)ethyl-(2-ethoxyethylsulfonyl)amino]propanoic acid.
| Compound Name | 3-[2-(2,5-dioxopyrrol-1-yl)ethyl-(2-ethoxyethylsulfonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 170071988 |
| Molecular Formula | C13H20N2O7S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 3-[2-(2,5-dioxopyrrol-1-yl)ethyl-(2-ethoxyethylsulfonyl)amino]propanoic acid |
| SMILES | CCOCCS(=O)(=O)N(CCC(=O)O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H20N2O7S/c1-2-22-9-10-23(20,21)14(6-5-13(18)19)7-8-15-11(16)3-4-12(15)17/h3-4H,2,5-10H2,1H3,(H,18,19) |
| InChIKey | XVGJETYXBMKHAZ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|