C11H15NO6 — CID 18718362
2-(2,5-dioxopyrrol-1-yl)ethyl 2-ethoxyethyl carbonate (PubChem CID 18718362) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)ethyl 2-ethoxyethyl carbonate.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)ethyl 2-ethoxyethyl carbonate |
|---|---|
| PubChem CID | 18718362 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)ethyl 2-ethoxyethyl carbonate |
| SMILES | CCOCCOC(=O)OCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H15NO6/c1-2-16-7-8-18-11(15)17-6-5-12-9(13)3-4-10(12)14/h3-4H,2,5-8H2,1H3 |
| InChIKey | DBOOTHBBVPCWPU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|