C8H11NO7S2 — CID 142617179
1-(2,5-dioxopyrrolidin-1-yl)oxy-1-oxo-4-sulfanylbutane-2-sulfonic acid (PubChem CID 142617179) has the molecular formula C8H11NO7S2 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)oxy-1-oxo-4-sulfanylbutane-2-sulfonic acid.
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)oxy-1-oxo-4-sulfanylbutane-2-sulfonic acid |
|---|---|
| PubChem CID | 142617179 |
| Molecular Formula | C8H11NO7S2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)oxy-1-oxo-4-sulfanylbutane-2-sulfonic acid |
| SMILES | O=C(ON1C(=O)CCC1=O)C(CCS)S(=O)(=O)O |
| InChI | InChI=1S/C8H11NO7S2/c10-6-1-2-7(11)9(6)16-8(12)5(3-4-17)18(13,14)15/h5,17H,1-4H2,(H,13,14,15) |
| InChIKey | SCZBVHKBWRQGDT-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|