C26H28N4O14S6 — CID 158024967
1-(2,5-dioxopyrrolidin-1-yl)oxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid (PubChem CID 158024967) has the molecular formula C26H28N4O14S6 and a molecular weight of 812.93 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)oxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid.
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)oxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 158024967 |
| Molecular Formula | C26H28N4O14S6 |
| Molecular Weight | 812.93 g/mol |
| Exact Mass | 811.99 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)oxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid |
| SMILES | O=C(ON1C(=O)CCC1=O)C(CCSSc1ccccn1)S(=O)(=O)O.O=C(ON1C(=O)CCC1=O)C(CCSSc1ccccn1)S(=O)(=O)O |
| InChI | InChI=1S/2C13H14N2O7S3/c2*16-11-4-5-12(17)15(11)22-13(18)9(25(19,20)21)6-8-23-24-10-3-1-2-7-14-10/h2*1-3,7,9H,4-6,8H2,(H,19,20,21) |
| InChIKey | FGMMTYIIGHQHMN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 261.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.93 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|