C20H28N2O4S3 — CID 123494064
1-[2-(4-ethylcyclohexa-1,3-dien-1-yl)ethyl-methylamino]-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid (PubChem CID 123494064) has the molecular formula C20H28N2O4S3 and a molecular weight of 456.66 g/mol. Its IUPAC name is 1-[2-(4-ethylcyclohexa-1,3-dien-1-yl)ethyl-methylamino]-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid.
| Compound Name | 1-[2-(4-ethylcyclohexa-1,3-dien-1-yl)ethyl-methylamino]-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 123494064 |
| Molecular Formula | C20H28N2O4S3 |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-[2-(4-ethylcyclohexa-1,3-dien-1-yl)ethyl-methylamino]-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid |
| SMILES | CCC1=CC=C(CCN(C)C(=O)C(CCSSc2ccccn2)S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C20H28N2O4S3/c1-3-16-7-9-17(10-8-16)11-14-22(2)20(23)18(29(24,25)26)12-15-27-28-19-6-4-5-13-21-19/h4-7,9,13,18H,3,8,10-12,14-15H2,1-2H3,(H,24,25,26) |
| InChIKey | UEQVEKTZJXXCSN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|