C26H36N4O6S3 — CID 118424003
N-[2-(4-acetylphenyl)ethyl]-N-methyl-2-[2-[3-(methylamino)-3-oxopropoxy]ethylsulfamoyl]-4-(pyridin-2-yldisulfanyl)butanamide (PubChem CID 118424003) has the molecular formula C26H36N4O6S3 and a molecular weight of 596.80 g/mol. Its IUPAC name is N-[2-(4-acetylphenyl)ethyl]-N-methyl-2-[2-[3-(methylamino)-3-oxopropoxy]ethylsulfamoyl]-4-(pyridin-2-yldisulfanyl)butanamide.
| Compound Name | N-[2-(4-acetylphenyl)ethyl]-N-methyl-2-[2-[3-(methylamino)-3-oxopropoxy]ethylsulfamoyl]-4-(pyridin-2-yldisulfanyl)butanamide |
|---|---|
| PubChem CID | 118424003 |
| Molecular Formula | C26H36N4O6S3 |
| Molecular Weight | 596.80 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | N-[2-(4-acetylphenyl)ethyl]-N-methyl-2-[2-[3-(methylamino)-3-oxopropoxy]ethylsulfamoyl]-4-(pyridin-2-yldisulfanyl)butanamide |
| SMILES | CNC(=O)CCOCCNS(=O)(=O)C(CCSSc1ccccn1)C(=O)N(C)CCc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C26H36N4O6S3/c1-20(31)22-9-7-21(8-10-22)11-16-30(3)26(33)23(13-19-37-38-25-6-4-5-14-28-25)39(34,35)29-15-18-36-17-12-24(32)27-2/h4-10,14,23,29H,11-13,15-19H2,1-3H3,(H,27,32) |
| InChIKey | GHUMUSJWTLVPKN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|