C14H20N2O5S2 — CID 163297013
2-[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethylamino]ethoxy]ethyl 2-hydroxypropanoate (PubChem CID 163297013) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethylamino]ethoxy]ethyl 2-hydroxypropanoate.
| Compound Name | 2-[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethylamino]ethoxy]ethyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 163297013 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethylamino]ethoxy]ethyl 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OCCOCC(=O)NCCSSc1ccccn1 |
| InChI | InChI=1S/C14H20N2O5S2/c1-11(17)14(19)21-8-7-20-10-12(18)15-6-9-22-23-13-4-2-3-5-16-13/h2-5,11,17H,6-10H2,1H3,(H,15,18) |
| InChIKey | KUIKOZDOKJSMRY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|