C14H16N4OS2 — CID 18965737
4-hydrazinyl-N-[2-(pyridin-2-yldisulfanyl)ethyl]benzamide (PubChem CID 18965737) has the molecular formula C14H16N4OS2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-hydrazinyl-N-[2-(pyridin-2-yldisulfanyl)ethyl]benzamide.
| Compound Name | 4-hydrazinyl-N-[2-(pyridin-2-yldisulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 18965737 |
| Molecular Formula | C14H16N4OS2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-hydrazinyl-N-[2-(pyridin-2-yldisulfanyl)ethyl]benzamide |
| SMILES | NNc1ccc(C(=O)NCCSSc2ccccn2)cc1 |
| InChI | InChI=1S/C14H16N4OS2/c15-18-12-6-4-11(5-7-12)14(19)17-9-10-20-21-13-3-1-2-8-16-13/h1-8,18H,9-10,15H2,(H,17,19) |
| InChIKey | IHHCILVYXOGFBL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|