C24H29N5O5S2 — CID 20686598
N-[4-oxo-4-[2-(pyridin-2-yldisulfanyl)ethylamino]butyl]-2-(2,3,4-trihydroxybutyl)quinoxaline-6-carboxamide (PubChem CID 20686598) has the molecular formula C24H29N5O5S2 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-[4-oxo-4-[2-(pyridin-2-yldisulfanyl)ethylamino]butyl]-2-(2,3,4-trihydroxybutyl)quinoxaline-6-carboxamide.
| Compound Name | N-[4-oxo-4-[2-(pyridin-2-yldisulfanyl)ethylamino]butyl]-2-(2,3,4-trihydroxybutyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 20686598 |
| Molecular Formula | C24H29N5O5S2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | N-[4-oxo-4-[2-(pyridin-2-yldisulfanyl)ethylamino]butyl]-2-(2,3,4-trihydroxybutyl)quinoxaline-6-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccc2nc(CC(O)C(O)CO)cnc2c1)NCCSSc1ccccn1 |
| InChI | InChI=1S/C24H29N5O5S2/c30-15-21(32)20(31)13-17-14-28-19-12-16(6-7-18(19)29-17)24(34)27-9-3-4-22(33)25-10-11-35-36-23-5-1-2-8-26-23/h1-2,5-8,12,14,20-21,30-32H,3-4,9-11,13,15H2,(H,25,33)(H,27,34) |
| InChIKey | SBQUJQBJHBXICI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|