C14H20N2O3S2 — CID 12795574
6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid (PubChem CID 12795574) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid.
| Compound Name | 6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 12795574 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C14H20N2O3S2/c17-12(15-9-4-1-2-7-14(18)19)8-11-20-21-13-6-3-5-10-16-13/h3,5-6,10H,1-2,4,7-9,11H2,(H,15,17)(H,18,19) |
| InChIKey | KPFOKUHANTWLRQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|