C9H11NO2S3 — CID 164606651
4-(pyridin-2-yltrisulfanyl)butanoic acid (PubChem CID 164606651) has the molecular formula C9H11NO2S3 and a molecular weight of 261.39 g/mol. Its IUPAC name is 4-(pyridin-2-yltrisulfanyl)butanoic acid.
| Compound Name | 4-(pyridin-2-yltrisulfanyl)butanoic acid |
|---|---|
| PubChem CID | 164606651 |
| Molecular Formula | C9H11NO2S3 |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 4-(pyridin-2-yltrisulfanyl)butanoic acid |
| SMILES | O=C(O)CCCSSSc1ccccn1 |
| InChI | InChI=1S/C9H11NO2S3/c11-9(12)5-3-7-13-15-14-8-4-1-2-6-10-8/h1-2,4,6H,3,5,7H2,(H,11,12) |
| InChIKey | GFKUCRRQYUWXJZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|