C13H19NO2S2 — CID 90322335
butyl 4-(pyridin-2-yldisulfanyl)butanoate (PubChem CID 90322335) has the molecular formula C13H19NO2S2 and a molecular weight of 285.43 g/mol. Its IUPAC name is butyl 4-(pyridin-2-yldisulfanyl)butanoate.
| Compound Name | butyl 4-(pyridin-2-yldisulfanyl)butanoate |
|---|---|
| PubChem CID | 90322335 |
| Molecular Formula | C13H19NO2S2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | butyl 4-(pyridin-2-yldisulfanyl)butanoate |
| SMILES | CCCCOC(=O)CCCSSc1ccccn1 |
| InChI | InChI=1S/C13H19NO2S2/c1-2-3-10-16-13(15)8-6-11-17-18-12-7-4-5-9-14-12/h4-5,7,9H,2-3,6,8,10-11H2,1H3 |
| InChIKey | TVAYWKHODVXCNP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|