C11H16N2O2S2 — CID 59937202
N-(ethoxymethyl)-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 59937202) has the molecular formula C11H16N2O2S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(ethoxymethyl)-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-(ethoxymethyl)-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 59937202 |
| Molecular Formula | C11H16N2O2S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-(ethoxymethyl)-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | CCOCNC(=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C11H16N2O2S2/c1-2-15-9-13-10(14)6-8-16-17-11-5-3-4-7-12-11/h3-5,7H,2,6,8-9H2,1H3,(H,13,14) |
| InChIKey | GQDNXHVIKQLXEZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|