C19H32N2O3S2 — CID 121265091
N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 121265091) has the molecular formula C19H32N2O3S2 and a molecular weight of 400.61 g/mol. Its IUPAC name is N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 121265091 |
| Molecular Formula | C19H32N2O3S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | COC(C)(C)CCOC(C)(C)CCNC(=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C19H32N2O3S2/c1-18(2,23-5)11-14-24-19(3,4)10-13-20-16(22)9-15-25-26-17-8-6-7-12-21-17/h6-8,12H,9-11,13-15H2,1-5H3,(H,20,22) |
| InChIKey | ZEABHXAREDXQHR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|