C25H41N5O3S2 — CID 129141605
N-[3-methyl-3-[3-methyl-3-[2-(4-propyltriazol-1-yl)ethoxy]butoxy]butyl]-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 129141605) has the molecular formula C25H41N5O3S2 and a molecular weight of 523.77 g/mol. Its IUPAC name is N-[3-methyl-3-[3-methyl-3-[2-(4-propyltriazol-1-yl)ethoxy]butoxy]butyl]-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-[3-methyl-3-[3-methyl-3-[2-(4-propyltriazol-1-yl)ethoxy]butoxy]butyl]-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 129141605 |
| Molecular Formula | C25H41N5O3S2 |
| Molecular Weight | 523.77 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | N-[3-methyl-3-[3-methyl-3-[2-(4-propyltriazol-1-yl)ethoxy]butoxy]butyl]-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | CCCc1cn(CCOC(C)(C)CCOC(C)(C)CCNC(=O)CCSSc2ccccn2)nn1 |
| InChI | InChI=1S/C25H41N5O3S2/c1-6-9-21-20-30(29-28-21)16-18-33-25(4,5)13-17-32-24(2,3)12-15-26-22(31)11-19-34-35-23-10-7-8-14-27-23/h7-8,10,14,20H,6,9,11-13,15-19H2,1-5H3,(H,26,31) |
| InChIKey | AUNSOHLTXPVJRY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.77 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|