C10H13IN2OS2 — CID 143766978
N-(2-iodoethyl)-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 143766978) has the molecular formula C10H13IN2OS2 and a molecular weight of 368.27 g/mol. Its IUPAC name is N-(2-iodoethyl)-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-(2-iodoethyl)-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 143766978 |
| Molecular Formula | C10H13IN2OS2 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | N-(2-iodoethyl)-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | O=C(CCSSc1ccccn1)NCCI |
| InChI | InChI=1S/C10H13IN2OS2/c11-5-7-12-9(14)4-8-15-16-10-3-1-2-6-13-10/h1-3,6H,4-5,7-8H2,(H,12,14) |
| InChIKey | KVIOPJWESBCUAO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|