C21H28N4O2S4 — CID 131993683
3-(pyridin-2-yldisulfanyl)-N-[5-[3-(pyridin-2-yldisulfanyl)propanoylamino]pentyl]propanamide (PubChem CID 131993683) has the molecular formula C21H28N4O2S4 and a molecular weight of 496.75 g/mol. Its IUPAC name is 3-(pyridin-2-yldisulfanyl)-N-[5-[3-(pyridin-2-yldisulfanyl)propanoylamino]pentyl]propanamide.
| Compound Name | 3-(pyridin-2-yldisulfanyl)-N-[5-[3-(pyridin-2-yldisulfanyl)propanoylamino]pentyl]propanamide |
|---|---|
| PubChem CID | 131993683 |
| Molecular Formula | C21H28N4O2S4 |
| Molecular Weight | 496.75 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 3-(pyridin-2-yldisulfanyl)-N-[5-[3-(pyridin-2-yldisulfanyl)propanoylamino]pentyl]propanamide |
| SMILES | O=C(CCSSc1ccccn1)NCCCCCNC(=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C21H28N4O2S4/c26-18(10-16-28-30-20-8-2-6-14-24-20)22-12-4-1-5-13-23-19(27)11-17-29-31-21-9-3-7-15-25-21/h2-3,6-9,14-15H,1,4-5,10-13,16-17H2,(H,22,26)(H,23,27) |
| InChIKey | LSHDJBVPOZVXIE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.75 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|