C19H24N4O3S2 — CID 123631637
4-amino-2-hydroxy-N-[4-[3-(pyridin-2-yldisulfanyl)propanoylamino]butyl]benzamide (PubChem CID 123631637) has the molecular formula C19H24N4O3S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 4-amino-2-hydroxy-N-[4-[3-(pyridin-2-yldisulfanyl)propanoylamino]butyl]benzamide.
| Compound Name | 4-amino-2-hydroxy-N-[4-[3-(pyridin-2-yldisulfanyl)propanoylamino]butyl]benzamide |
|---|---|
| PubChem CID | 123631637 |
| Molecular Formula | C19H24N4O3S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-amino-2-hydroxy-N-[4-[3-(pyridin-2-yldisulfanyl)propanoylamino]butyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCCCCNC(=O)CCSSc2ccccn2)c(O)c1 |
| InChI | InChI=1S/C19H24N4O3S2/c20-14-6-7-15(16(24)13-14)19(26)23-11-4-3-9-21-17(25)8-12-27-28-18-5-1-2-10-22-18/h1-2,5-7,10,13,24H,3-4,8-9,11-12,20H2,(H,21,25)(H,23,26) |
| InChIKey | OFSQBFQVQBAONB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|