C20H23N5O3S2 — CID 58150420
4-azido-2-hydroxy-N-[6-oxo-8-(pyridin-2-yldisulfanyl)octyl]benzamide (PubChem CID 58150420) has the molecular formula C20H23N5O3S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 4-azido-2-hydroxy-N-[6-oxo-8-(pyridin-2-yldisulfanyl)octyl]benzamide.
| Compound Name | 4-azido-2-hydroxy-N-[6-oxo-8-(pyridin-2-yldisulfanyl)octyl]benzamide |
|---|---|
| PubChem CID | 58150420 |
| Molecular Formula | C20H23N5O3S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 4-azido-2-hydroxy-N-[6-oxo-8-(pyridin-2-yldisulfanyl)octyl]benzamide |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)NCCCCCC(=O)CCSSc2ccccn2)c(O)c1 |
| InChI | InChI=1S/C20H23N5O3S2/c21-25-24-15-8-9-17(18(27)14-15)20(28)23-12-4-1-2-6-16(26)10-13-29-30-19-7-3-5-11-22-19/h3,5,7-9,11,14,27H,1-2,4,6,10,12-13H2,(H,23,28) |
| InChIKey | AYJMIEBIDKLYMP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|