C16H17N5O6S2 — CID 10365912
(2,5-dioxopyrrolidin-1-yl) 3-[2-[(4-azido-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoate (PubChem CID 10365912) has the molecular formula C16H17N5O6S2 and a molecular weight of 439.48 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[(4-azido-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[(4-azido-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoate |
|---|---|
| PubChem CID | 10365912 |
| Molecular Formula | C16H17N5O6S2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[(4-azido-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoate |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)NCCSSCCC(=O)ON2C(=O)CCC2=O)c(O)c1 |
| InChI | InChI=1S/C16H17N5O6S2/c17-20-19-10-1-2-11(12(22)9-10)16(26)18-6-8-29-28-7-5-15(25)27-21-13(23)3-4-14(21)24/h1-2,9,22H,3-8H2,(H,18,26) |
| InChIKey | NZQKESJXQKCMQS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 161.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|