C13H10N4O4 — CID 71330676
(2,5-dioxopyrrolidin-1-yl) 3-(4-azidophenyl)prop-2-enoate (PubChem CID 71330676) has the molecular formula C13H10N4O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(4-azidophenyl)prop-2-enoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-azidophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71330676 |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-azidophenyl)prop-2-enoate |
| SMILES | [N-]=[N+]=Nc1ccc(C=CC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C13H10N4O4/c14-16-15-10-4-1-9(2-5-10)3-8-13(20)21-17-11(18)6-7-12(17)19/h1-5,8H,6-7H2 |
| InChIKey | WTOOFLQUPWOYGG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 112.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|