C17H19N5O6 — CID 158500835
(2,5-dioxopyrrolidin-1-yl) 7-(4-azido-2-nitrophenyl)heptanoate (PubChem CID 158500835) has the molecular formula C17H19N5O6 and a molecular weight of 389.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 7-(4-azido-2-nitrophenyl)heptanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 7-(4-azido-2-nitrophenyl)heptanoate |
|---|---|
| PubChem CID | 158500835 |
| Molecular Formula | C17H19N5O6 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 7-(4-azido-2-nitrophenyl)heptanoate |
| SMILES | [N-]=[N+]=Nc1ccc(CCCCCCC(=O)ON2C(=O)CCC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19N5O6/c18-20-19-13-8-7-12(14(11-13)22(26)27)5-3-1-2-4-6-17(25)28-21-15(23)9-10-16(21)24/h7-8,11H,1-6,9-10H2 |
| InChIKey | HAIJPOPKYGUMDS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 155.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|