C14H22N4O4 — CID 155887418
(2,5-dioxopyrrolidin-1-yl) 10-azidodecanoate (PubChem CID 155887418) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 10-azidodecanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 10-azidodecanoate |
|---|---|
| PubChem CID | 155887418 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 10-azidodecanoate |
| SMILES | [N-]=[N+]=NCCCCCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H22N4O4/c15-17-16-11-7-5-3-1-2-4-6-8-14(21)22-18-12(19)9-10-13(18)20/h1-11H2 |
| InChIKey | JACYPJQKNFOKPE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|