C11H15N5O5 — CID 154963897
(2,5-dioxopyrrolidin-1-yl) 3-[(4-azido-2-oxobutyl)amino]propanoate (PubChem CID 154963897) has the molecular formula C11H15N5O5 and a molecular weight of 297.27 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[(4-azido-2-oxobutyl)amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[(4-azido-2-oxobutyl)amino]propanoate |
|---|---|
| PubChem CID | 154963897 |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[(4-azido-2-oxobutyl)amino]propanoate |
| SMILES | [N-]=[N+]=NCCC(=O)CNCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H15N5O5/c12-15-14-6-3-8(17)7-13-5-4-11(20)21-16-9(18)1-2-10(16)19/h13H,1-7H2 |
| InChIKey | HMINZCDPJYOBGW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|