C18H29BrN2O9 — CID 87261762
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(3-bromo-2-oxopropyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 87261762) has the molecular formula C18H29BrN2O9 and a molecular weight of 497.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(3-bromo-2-oxopropyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(3-bromo-2-oxopropyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 87261762 |
| Molecular Formula | C18H29BrN2O9 |
| Molecular Weight | 497.34 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(3-bromo-2-oxopropyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | O=C(CBr)CNCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C18H29BrN2O9/c19-13-15(22)14-20-4-6-27-8-10-29-12-11-28-9-7-26-5-3-18(25)30-21-16(23)1-2-17(21)24/h20H,1-14H2 |
| InChIKey | OAVRGOGCPPEHMY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.34 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|