C14H14N6O6 — CID 22630715
2-(4-azido-2-nitroanilino)-2-(2,5-dioxopyrrolidin-1-yl)butanoic acid (PubChem CID 22630715) has the molecular formula C14H14N6O6 and a molecular weight of 362.30 g/mol. Its IUPAC name is 2-(4-azido-2-nitroanilino)-2-(2,5-dioxopyrrolidin-1-yl)butanoic acid.
| Compound Name | 2-(4-azido-2-nitroanilino)-2-(2,5-dioxopyrrolidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 22630715 |
| Molecular Formula | C14H14N6O6 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-(4-azido-2-nitroanilino)-2-(2,5-dioxopyrrolidin-1-yl)butanoic acid |
| SMILES | CCC(Nc1ccc(N=[N+]=[N-])cc1[N+](=O)[O-])(C(=O)O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C14H14N6O6/c1-2-14(13(23)24,19-11(21)5-6-12(19)22)16-9-4-3-8(17-18-15)7-10(9)20(25)26/h3-4,7,16H,2,5-6H2,1H3,(H,23,24) |
| InChIKey | GQLZJGSPRBQBDY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 178.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|