C11H12N6O5 — CID 171595365
2-(4-azido-2-nitroanilino)ethyl N-(2-oxoethyl)carbamate (PubChem CID 171595365) has the molecular formula C11H12N6O5 and a molecular weight of 308.25 g/mol. Its IUPAC name is 2-(4-azido-2-nitroanilino)ethyl N-(2-oxoethyl)carbamate.
| Compound Name | 2-(4-azido-2-nitroanilino)ethyl N-(2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 171595365 |
| Molecular Formula | C11H12N6O5 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(4-azido-2-nitroanilino)ethyl N-(2-oxoethyl)carbamate |
| SMILES | [N-]=[N+]=Nc1ccc(NCCOC(=O)NCC=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N6O5/c12-16-15-8-1-2-9(10(7-8)17(20)21)13-4-6-22-11(19)14-3-5-18/h1-2,5,7,13H,3-4,6H2,(H,14,19) |
| InChIKey | QFRJOLNDSJQHLG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 159.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|