C19H26N6O6 — CID 176786820
(2R,3R,4R,5S)-1-[[3-[(4-azido-2-nitroanilino)methyl]-1-bicyclo[1.1.1]pentanyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 176786820) has the molecular formula C19H26N6O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[[3-[(4-azido-2-nitroanilino)methyl]-1-bicyclo[1.1.1]pentanyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[[3-[(4-azido-2-nitroanilino)methyl]-1-bicyclo[1.1.1]pentanyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 176786820 |
| Molecular Formula | C19H26N6O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (2R,3R,4R,5S)-1-[[3-[(4-azido-2-nitroanilino)methyl]-1-bicyclo[1.1.1]pentanyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | [N-]=[N+]=Nc1ccc(NCC23CC(CN4C[C@H](O)[C@@H](O)[C@H](O)[C@H]4CO)(C2)C3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H26N6O6/c20-23-22-11-1-2-12(13(3-11)25(30)31)21-9-18-6-19(7-18,8-18)10-24-4-15(27)17(29)16(28)14(24)5-26/h1-3,14-17,21,26-29H,4-10H2/t14-,15+,16-,17-,18?,19?/m1/s1 |
| InChIKey | LBIAUHDJQWJPHF-LVFOMFCBSA-N |
| XLogP | 0.88 |
| TPSA | 188.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|