C20H33N3O7 — CID 172824555
(2R,3R,4R,5S)-1-[6-[4-(2-hydroxyethyl)-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 172824555) has the molecular formula C20H33N3O7 and a molecular weight of 427.50 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[6-[4-(2-hydroxyethyl)-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[6-[4-(2-hydroxyethyl)-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 172824555 |
| Molecular Formula | C20H33N3O7 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (2R,3R,4R,5S)-1-[6-[4-(2-hydroxyethyl)-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | O=[N+]([O-])c1cc(CCO)ccc1NCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C20H33N3O7/c24-10-7-14-5-6-15(16(11-14)23(29)30)21-8-3-1-2-4-9-22-12-18(26)20(28)19(27)17(22)13-25/h5-6,11,17-21,24-28H,1-4,7-10,12-13H2/t17-,18+,19-,20-/m1/s1 |
| InChIKey | URKFELDUAGAJHM-IYWMVGAKSA-N |
| XLogP | -0.14 |
| TPSA | 159.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|