C23H32N4O6 — CID 121330460
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(2-nitro-4-pyridin-3-ylanilino)hexyl]piperidine-3,4,5-triol (PubChem CID 121330460) has the molecular formula C23H32N4O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(2-nitro-4-pyridin-3-ylanilino)hexyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(2-nitro-4-pyridin-3-ylanilino)hexyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 121330460 |
| Molecular Formula | C23H32N4O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(2-nitro-4-pyridin-3-ylanilino)hexyl]piperidine-3,4,5-triol |
| SMILES | O=[N+]([O-])c1cc(-c2cccnc2)ccc1NCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C23H32N4O6/c28-15-20-22(30)23(31)21(29)14-26(20)11-4-2-1-3-10-25-18-8-7-16(12-19(18)27(32)33)17-6-5-9-24-13-17/h5-9,12-13,20-23,25,28-31H,1-4,10-11,14-15H2/t20-,21+,22-,23-/m1/s1 |
| InChIKey | LKYUPCDWTWWWKO-KAOXLYBCSA-N |
| XLogP | 1.39 |
| TPSA | 152.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|