C24H40N4O6 — CID 121330420
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[2-nitro-4-(piperidin-1-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol (PubChem CID 121330420) has the molecular formula C24H40N4O6 and a molecular weight of 480.61 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[2-nitro-4-(piperidin-1-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[2-nitro-4-(piperidin-1-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 121330420 |
| Molecular Formula | C24H40N4O6 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[2-nitro-4-(piperidin-1-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol |
| SMILES | O=[N+]([O-])c1cc(CN2CCCCC2)ccc1NCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C24H40N4O6/c29-17-21-23(31)24(32)22(30)16-27(21)13-7-2-1-4-10-25-19-9-8-18(14-20(19)28(33)34)15-26-11-5-3-6-12-26/h8-9,14,21-25,29-32H,1-7,10-13,15-17H2/t21-,22+,23-,24-/m1/s1 |
| InChIKey | MKXHBTULSDHTAD-UEQSERJNSA-N |
| XLogP | 1.31 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|