C23H39N5O6 — CID 121330425
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[2-nitro-4-(piperazin-1-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol (PubChem CID 121330425) has the molecular formula C23H39N5O6 and a molecular weight of 481.59 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[2-nitro-4-(piperazin-1-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[2-nitro-4-(piperazin-1-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 121330425 |
| Molecular Formula | C23H39N5O6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[2-nitro-4-(piperazin-1-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol |
| SMILES | O=[N+]([O-])c1cc(CN2CCNCC2)ccc1NCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C23H39N5O6/c29-16-20-22(31)23(32)21(30)15-27(20)10-4-2-1-3-7-25-18-6-5-17(13-19(18)28(33)34)14-26-11-8-24-9-12-26/h5-6,13,20-25,29-32H,1-4,7-12,14-16H2/t20-,21+,22-,23-/m1/s1 |
| InChIKey | WLABGJFFDKQENC-KAOXLYBCSA-N |
| XLogP | -0.27 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|