C21H36N4O6 — CID 121330422
(2R,3R,4R,5S)-1-[6-[5-[(dimethylamino)methyl]-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 121330422) has the molecular formula C21H36N4O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[6-[5-[(dimethylamino)methyl]-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[6-[5-[(dimethylamino)methyl]-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 121330422 |
| Molecular Formula | C21H36N4O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | (2R,3R,4R,5S)-1-[6-[5-[(dimethylamino)methyl]-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CN(C)Cc1ccc([N+](=O)[O-])c(NCCCCCCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)c1 |
| InChI | InChI=1S/C21H36N4O6/c1-23(2)12-15-7-8-17(25(30)31)16(11-15)22-9-5-3-4-6-10-24-13-19(27)21(29)20(28)18(24)14-26/h7-8,11,18-22,26-29H,3-6,9-10,12-14H2,1-2H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | UHUASGJBCHGVHC-PLACYPQZSA-N |
| XLogP | 0.39 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|