C18H28N6O8 — CID 175895889
(2R,3R,4R,5S)-1-[6-(4-azido-2-nitroanilino)-3,4-dihydroxyhexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 175895889) has the molecular formula C18H28N6O8 and a molecular weight of 456.46 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[6-(4-azido-2-nitroanilino)-3,4-dihydroxyhexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[6-(4-azido-2-nitroanilino)-3,4-dihydroxyhexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 175895889 |
| Molecular Formula | C18H28N6O8 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (2R,3R,4R,5S)-1-[6-(4-azido-2-nitroanilino)-3,4-dihydroxyhexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | [N-]=[N+]=Nc1ccc(NCCC(O)C(O)CCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H28N6O8/c19-22-21-10-1-2-11(12(7-10)24(31)32)20-5-3-14(26)15(27)4-6-23-8-16(28)18(30)17(29)13(23)9-25/h1-2,7,13-18,20,25-30H,3-6,8-9H2/t13-,14?,15?,16+,17-,18-/m1/s1 |
| InChIKey | BSGVTLXBMNAQNE-DKBPHIGXSA-N |
| XLogP | -0.79 |
| TPSA | 228.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|