C19H26N8O6 — CID 172812731
(2R,3R,4R,5S)-1-[2-[4-[2-(4-azido-2-nitroanilino)ethyl]pyrazol-1-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 172812731) has the molecular formula C19H26N8O6 and a molecular weight of 462.47 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-[4-[2-(4-azido-2-nitroanilino)ethyl]pyrazol-1-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[2-[4-[2-(4-azido-2-nitroanilino)ethyl]pyrazol-1-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 172812731 |
| Molecular Formula | C19H26N8O6 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-[4-[2-(4-azido-2-nitroanilino)ethyl]pyrazol-1-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | [N-]=[N+]=Nc1ccc(NCCc2cnn(CCN3C[C@H](O)[C@@H](O)[C@H](O)[C@H]3CO)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H26N8O6/c20-24-23-13-1-2-14(15(7-13)27(32)33)21-4-3-12-8-22-26(9-12)6-5-25-10-17(29)19(31)18(30)16(25)11-28/h1-2,7-9,16-19,21,28-31H,3-6,10-11H2/t16-,17+,18-,19-/m1/s1 |
| InChIKey | SKCCLGVVQMMMIQ-FCGDIQPGSA-N |
| XLogP | 0.15 |
| TPSA | 205.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|