C19H24N6O6S — CID 175895616
1-[2-[5-[(4-azido-2-nitroanilino)methyl]thiophen-3-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 175895616) has the molecular formula C19H24N6O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is 1-[2-[5-[(4-azido-2-nitroanilino)methyl]thiophen-3-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | 1-[2-[5-[(4-azido-2-nitroanilino)methyl]thiophen-3-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 175895616 |
| Molecular Formula | C19H24N6O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 1-[2-[5-[(4-azido-2-nitroanilino)methyl]thiophen-3-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | [N-]=[N+]=Nc1ccc(NCc2cc(CCN3CC(O)C(O)C(O)C3CO)cs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H24N6O6S/c20-23-22-12-1-2-14(15(6-12)25(30)31)21-7-13-5-11(10-32-13)3-4-24-8-17(27)19(29)18(28)16(24)9-26/h1-2,5-6,10,16-19,21,26-29H,3-4,7-9H2 |
| InChIKey | OXIDAFKKWIFBKJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 188.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|